| Name |
Delphinidin 3-sambubioside |
| Formula |
C26H29O16 |
| Mw |
597.14555988 |
| CAS RN |
53158-73-9 |
| C_ID |
C00006704
, 
|
| InChIKey |
TWYYVOVDSNRIJM-COOYZXCUNA-O |
| InChICode |
InChI=1S/C26H28O16/c27-6-17-20(35)21(36)24(42-25-22(37)19(34)14(32)7-38-25)26(41-17)40-16-5-10-11(29)3-9(28)4-15(10)39-23(16)8-1-12(30)18(33)13(31)2-8/h1-5,14,17,19-22,24-27,32,34-37H,6-7H2,(H4-,28,29,30,31,33)/p+1/t14-,17+,19-,20+,21-,22-,24+,25+,26+/m0/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)C(O[C@@H]2OC[C@@H](O)C(O)[C@H]2O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Cotyledon spp. | Ref. |
| Plantae | Crassulaceae | Crassula spp. | Ref. |
| Plantae | Crassulaceae | Tylecodon spp. | Ref. |
| Plantae | Daphniphyllaceae | Daphniphyllum macropodum | Ref. |
| Plantae | Fabaceae | Abrus precatorius  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Lecythidaceae | Barringtonia macrostapha | Ref. |
| Plantae | Lecythidaceae | Barringtonia racemosa  | Ref. |
| Plantae | Malvaceae | Hibiscus sabdariffa  | Ref. |
| Plantae | Ranunculaceae | Ranunculus asiaticus | Ref. |
| Plantae | Symplocaceae | Symplocos lucida | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Hibiscus sabdariffa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Shibata,Bot.Mag.Tokyo.,77,(1964),277
Lowry,Phytochem.,15,(1976),513 |
|---|
|