| Name |
Limocitrin 3-O-beta-D-glucopyranoside Limocitrin 3-O-beta-glucopyranoside Limocitrin 3-glucoside |
| Formula |
C23H24O13 |
| Mw |
508.12169086 |
| CAS RN |
38836-51-0 |
| C_ID |
C00005715
, 
|
| InChIKey |
XZGXHUKLGCOGII-BAAUHUGTNA-N |
| InChICode |
InChI=1S/C23H24O13/c1-32-12-5-8(3-4-9(12)25)19-22(36-23-18(31)17(30)15(28)13(7-24)34-23)16(29)14-10(26)6-11(27)20(33-2)21(14)35-19/h3-6,13,15,17-18,23-28,30-31H,7H2,1-2H3/t13-,15-,17+,18-,23+/m1/s1 |
| SMILES |
COc1cc(-c2oc3c(OC)c(O)cc(O)c3c(=O)c2O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Sedum acre  | Ref. |
| Plantae | Crassulaceae | Sedum alfredi | Ref. |
| Plantae | Crassulaceae | Sedum reflexum  | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Primulaceae | Primula officinalis  | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus unshiu  | Ref. |
| Plantae | Rutaceae | Haplophyllum pedicellatum | Ref. |
|
|
zoom in
| Organism | Citrus unshiu | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Gentili,Tetrahedron,20,(1964),2313
Ulubelen,Phytochem.,23,(1984),2941 |
|---|
|