| Name |
Laricitrin |
| Formula |
C16H12O8 |
| Mw |
332.05321736 |
| CAS RN |
53472-37-0 |
| C_ID |
C00004763
, 
|
| InChIKey |
CFYMYCCYMJIYAB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O8/c1-23-11-3-6(2-9(19)13(11)20)16-15(22)14(21)12-8(18)4-7(17)5-10(12)24-16/h2-5,17-20,22H,1H3 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Sedum crassipes | Ref. |
| Plantae | Fabaceae | Medicago arborea | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Limnanthaceae | Limnanthes douglasii | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Pinaceae | Cedrus atlantica Manetii cv.glauca | Ref. |
| Plantae | Pinaceae | Cedrus spp. | Ref. |
| Plantae | Pinaceae | Larix spp. | Ref. |
| Plantae | Plumbaginaceae | Limonium sinuatum  | Ref. |
| Plantae | Restionaceae | Chondropetalum hookerianum | Ref. |
|
|
zoom in
| Organism | Larix spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Parker,Phytochem.,14,(1975),553 |
|---|
|