| Name |
Spinacetin 3,4',5,7-Tetrahydroxy-3',6-dimethoxyflavone Quercetagetin 3',6-dimethyl ether 3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
3153-83-1 |
| C_ID |
C00004689
, 
|
| InChIKey |
XWIDINOKCRFVHQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-10-5-7(3-4-8(10)18)16-15(22)13(20)12-11(25-16)6-9(19)17(24-2)14(12)21/h3-6,18-19,21-22H,1-2H3 |
| SMILES |
COc1cc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anthemis tinctoria  | Ref. |
| Plantae | Asteraceae | Arnica spp. | Ref. |
| Plantae | Asteraceae | Balsamorhiza sagittata | Ref. |
| Plantae | Asteraceae | Brickellia californica | Ref. |
| Plantae | Asteraceae | Decachaeta haenkeana | Ref. |
| Plantae | Asteraceae | Eriophyllum confertiflorum | Ref. |
| Plantae | Asteraceae | Gutierrezia spp. | Ref. |
| Plantae | Asteraceae | Hazardia squarrosa | Ref. |
| Plantae | Asteraceae | Inula viscosa  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Tetragonotheca spp. | Ref. |
| Plantae | Asteraceae | Wyethia agnorhiza | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Inula viscosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Zane,J.Org.Chem.,26,(1961),4718 |
|---|
|