| Name |
Tricin 7-O-beta-D-glucopyranoside Tricin 7-O-glucoside Tricin 7-glucoside |
| Formula |
C23H24O12 |
| Mw |
492.12677623 |
| CAS RN |
32769-01-0 |
| C_ID |
C00004444
, 
|
| InChIKey |
JGXFMIJHKASCIZ-GWXIPAPMNA-N |
| InChICode |
InChI=1S/C23H24O12/c1-31-15-3-9(4-16(32-2)19(15)27)13-7-12(26)18-11(25)5-10(6-14(18)34-13)33-23-22(30)21(29)20(28)17(8-24)35-23/h3-7,17,20-25,27-30H,8H2,1-2H3/t17-,20+,21-,22+,23+/m0/s1 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc3o2)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Labiatae | Stachys alopecuros (L.) Benth. | Ref. |
| Plantae | Labiatae | Stachys officinalis (L.) Trev.  | Ref. |
| Plantae | Labiatae | Stachys scardica Griseb. | Ref. |
| Plantae | Palmae | Butia capitata  | Ref. |
| Plantae | Palmae | Rhopaloblaste singaporensis | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Oryza spp. | Ref. |
| Plantae | Poaceae | Triticum spp. | Ref. |
| Plantae | Ranunculaceae | Ranunculus japonicus | Ref. |
| Plantae | Rhizophoraceae | Bruguiera sexangula var.rhynchopetala | Ref. |
|
|
zoom in
| Organism | Triticum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Kuwatsuka,Nippon Nogei Kagaku Kaishi,38,(1964),351 |
|---|
|