| Name |
Gardenin D 5,3'-Dihydroxy-6,7,8,4'-tetramethoxyflavone 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
29202-00-4 |
| C_ID |
C00003933
, 
|
| InChIKey |
DQMSOZCDDAULPH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-12-6-5-9(7-10(12)20)13-8-11(21)14-15(22)17(24-2)19(26-4)18(25-3)16(14)27-13/h5-8,20,22H,1-4H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis patens | Ref. |
| Plantae | Asteraceae | Baccharis spp. | Ref. |
| Plantae | Asteraceae | Calycadenia truncata | Ref. |
| Plantae | Asteraceae | Calycadenia villosa | Ref. |
| Plantae | Labiatae | Isodon rubescens var.lushiensis | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Mentha x piperita | Ref. |
| Plantae | Labiatae | Sideritis jahandiezii | Ref. |
| Plantae | Labiatae | Sideritis mugronensis | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
|
|
zoom in
| Organism | Sideritis mugronensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Rodriguez,Phytochem.,16,(1977),800
Tomas-Barberan,Phytochem.,27,(1988),165 |
|---|
|