| Name |
Skullcapflavone I 5-Hydroxy-2-(2-hydroxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
41060-16-6 |
| C_ID |
C00003844
, 
|
| InChIKey |
CZRGNFVQUYWGKP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-14-8-12(20)15-11(19)7-13(23-17(15)16(14)22-2)9-5-3-4-6-10(9)18/h3-8,18,20H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccccc3O)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Andrographis affinis | Ref. |
| Plantae | Acanthaceae | Andrographis elongata | Ref. |
| Plantae | Acanthaceae | Andrographis lineata  | Ref. |
| Plantae | Acanthaceae | Andrographis rothii | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria planipes | Ref. |
| Plantae | Labiatae | Scutellaria rivularis  | Ref. |
| Plantae | Plantaginaceae | Limnophila indica  | Ref. |
| Plantae | Pteridaceae | Notholaena reflecta | Ref. |
| Plantae | Pteridaceae | Notholaena sulphurea | Ref. |
|
|
zoom in
| Organism | Notholaena reflecta | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Takido,Yakugaku Zasshi,99,(1979),443
Scheele,J.Nat.Prod.,50,(1987),181 |
|---|
|