| Name |
5,7,4'-Trimethoxyflavone Apigenin 5,7,4'-trimethyl ether |
| Formula |
C18H16O5 |
| Mw |
312.09977362 |
| CAS RN |
5631-70-9 |
| C_ID |
C00003821
, 
|
| InChIKey |
ZXJJBDHPUHUUHD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O5/c1-20-12-6-4-11(5-7-12)15-10-14(19)18-16(22-3)8-13(21-2)9-17(18)23-15/h4-10H,1-3H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(OC)cc(OC)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia kola  | Ref. |
| Plantae | Labiatae | Orthosiphon spicatus | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus grandis  | Ref. |
| Plantae | Rutaceae | Citrus grandis var.tomentosa  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Boesenbergia pandurata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Iinuma, Yakugaku Zasshi, 100,(1980),657
Jaipetch,Phytochem.,22,(1983),625 |
|---|
|