| Name |
7-O-Methylwogonin 7-O-Methylwogonine Moslosooflavone 5-Hydroxy-7,8-dimethoxyflavone |
| Formula |
C17H14O5 |
| Mw |
298.08412356 |
| CAS RN |
3570-62-5 |
| C_ID |
C00003810
, 
|
| InChIKey |
IHLSBQVBFDTNTC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O5/c1-20-14-9-12(19)15-11(18)8-13(10-6-4-3-5-7-10)22-17(15)16(14)21-2/h3-9,19H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Andrographis affinis | Ref. |
| Plantae | Acanthaceae | Andrographis paniculata  | Ref. |
| Plantae | Annonaceae | Uvaria rufa | Ref. |
| Plantae | Asteraceae | Achyrocline bogotensis (HBK.) DC. | Ref. |
| Plantae | Asteraceae | Gnaphalium pellitum | Ref. |
| Plantae | Labiatae | Collinsonia canadensis  | Ref. |
| Plantae | Labiatae | Mosla soochouensis | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria rivularis  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus solandri | Ref. |
| Plantae | Plantaginaceae | Limnophila indica  | Ref. |
|
|
zoom in
| Organism | Scutellaria rivularis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Chou,J.Taiwan.Pharm.Assoc.,30,(1978),36
Escarria,Phytochem.,16,(1977),1618 |
|---|
|