| Name |
3-Friedelanone Friedelin Friedelan-3-one Friedelanone Friedeline (-)-Friedelin |
| Formula |
C30H50O |
| Mw |
426.38616622 |
| CAS RN |
559-74-0 |
| C_ID |
C00003747
, 
|
| InChIKey |
OFMXGFHWLZPCFL-HNGQCKEFNA-N |
| InChICode |
InChI=1S/C30H50O/c1-20-21(31)9-10-22-27(20,5)12-11-23-28(22,6)16-18-30(8)24-19-25(2,3)13-14-26(24,4)15-17-29(23,30)7/h20,22-24H,9-19H2,1-8H3/t20-,22+,23-,24+,26+,27+,28-,29+,30-/m0/s1 |
| SMILES |
C[C@H]1C(=O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@@]2(C)CC[C@@]2(C)[C@@H]3CC(C)(C)CC[C@]3(C)CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Ganodermataceae | Ganoderma applanatum  | Ref. |
| Plantae | Apocynaceae | Tabernaemontana catharinensis | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Asteraceae | Inula cappa  | Ref. |
| Plantae | Asteraceae | Isocoma wrightii | Ref. |
| Plantae | Asteraceae | Stevia porphyrea | Ref. |
| Plantae | Asteraceae | Viguiera decurrens | Ref. |
| Plantae | Boraginaceae | Heliotropium marifolium | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum cordato-oblongum | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum pinetorum | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen OLIV.  | Ref. |
| Plantae | Cannabaceae | Cannabis inflorescences | Ref. |
| Plantae | Celastraceae | Kokoona zeylanica Thwaites | Ref. |
| Plantae | Celastraceae | Maytenus aquifolium | Ref. |
| Plantae | Celastraceae | Maytenus macrocarpa  | Ref. |
| Plantae | Celastraceae | Salacia campestris | Ref. |
| Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
| Plantae | Clusiaceae | Tripetalum cymosum | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Clusia nemorosa  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae-Guttiferae | Endodesmia calophylloides | Ref. |
| Plantae | Clusiaceae-Guttiferae | Kielmeyera elata | Ref. |
| Plantae | Clusiaceae-Guttiferae | Tovomita brasiliensis | Ref. |
| Plantae | Combretaceae | Pteleopsis hylodendron | Ref. |
| Plantae | Crassulaceae | Kalanchoe daigremontiana | Ref. |
| Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
| Plantae | Cunoniaceae | Ceratopetalum apetalum | Ref. |
| Plantae | Cyatheaceae | Cyathea podophylla | Ref. |
| Plantae | Ebenaceae | Diospyros eriantha | Ref. |
| Plantae | Ebenaceae | Diospyros maritima BLUME  | Ref. |
| Plantae | Ericaceae | Erica arborea L.  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum subsessile | Ref. |
| Plantae | Euphorbiaceae | Euphorbia segetalis  | Ref. |
| Plantae | Euphorbiaceae | Sapium sebiferum  | Ref. |
| Plantae | Fabaceae | Cassia siamea Lamk.  | Ref. |
| Plantae | Fabaceae | Dalea tuberculata | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Mimosa rubicaulis | Ref. |
| Plantae | Fabaceae | Pentaclethra macroloba  | Ref. |
| Plantae | Fagaceae | Quercus glauca Thunb.  | Ref. |
| Plantae | Fagaceae | Quercus myrsenaefolia | Ref. |
| Plantae | Fagaceae | Quercus stenophylla Makino. | Ref. |
| Plantae | Fagaceae | Quercus suber  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Hypericaceae | Harungana madagascariensis  | Ref. |
| Plantae | Hypericaceae | Hypericum lanceolatum | Ref. |
| Plantae | Hypericaceae | Psorospermum glaberrimum | Ref. |
| Plantae | Hypericaceae | Vismia laurentii  | Ref. |
| Plantae | Labiatae | Vitex trifolia  | Ref. |
| Plantae | Lauraceae | Machilus zuihoensis | Ref. |
| Plantae | Malvaceae | Adansonia digitata  | Ref. |
| Plantae | Myrsinaceae | Ardisia japonica  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Myrtaceae | Syzygium formosanum | Ref. |
| Plantae | Oleaceae | Nyctanthes arbor-tristis Linn.  | Ref. |
| Plantae | Phyllanthaceae | Glochidion puberum | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus reticulatus  | Ref. |
| Plantae | Pinaceae | Larix kaempferi (Lamb.) Carr | Ref. |
| Plantae | Piperaceae | Piper umbellatum  | Ref. |
| Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta  | Ref. |
| Plantae | Putranjivaceae | Drypetes inaequalis | Ref. |
| Plantae | Putranjivaceae | Drypetes tessmanniana | Ref. |
| Plantae | Rutaceae | Murraya euchrestifolia | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Ulmaceae | Ulmus campestris  | Ref. |
| Plantae | Ulmaceae | Ulmus pumila L.  | Ref. |
| - | - | Bishofia javanica | Ref. |
| - | - | Flueggea microcarpa  | Ref. |
| - | - | Gymnaster koraiensis | Ref. |
|
|
zoom in
| Organism | Heliotropium marifolium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|