| Name |
Cornin Verbenalin |
| Formula |
C17H24O10 |
| Mw |
388.13694699 |
| CAS RN |
548-37-8 |
| C_ID |
C00003102
, 
|
| InChIKey |
HLXRWTJXGMHOFN-FGBKZHRTNA-N |
| InChICode |
InChI=1S/C17H24O10/c1-6-3-8(19)11-7(15(23)24-2)5-25-16(10(6)11)27-17-14(22)13(21)12(20)9(4-18)26-17/h5-6,9-14,16-18,20-22H,3-4H2,1-2H3/t6-,9+,10+,11-,12+,13-,14+,16-,17-/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)[C@H]2[C@@H]1C(=O)C[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus florida | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus spp. | Ref. |
| Plantae | Plantaginaceae | Penstemon grandiflorus | Ref. |
| Plantae | Plantaginaceae | Penstemon mucronatus | Ref. |
| Plantae | Plantaginaceae | Penstemon secundiflorus | Ref. |
| Plantae | Symplocaceae | Symplocos glauca | Ref. |
| Plantae | Verbenaceae | Verbena brasiliensis | Ref. |
| Plantae | Verbenaceae | Verbena hastata | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| Plantae | Verbenaceae | Verbena spp. | Ref. |
| Plantae | Verbenaceae | Verbena stricta | Ref. |
|
|
zoom in
| Organism | Verbena brasiliensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|