| Name |
Plantamajoside |
| Formula |
C29H36O16 |
| Mw |
640.20033511 |
| CAS RN |
104777-68-6 |
| C_ID |
C00002767
, 
|
| InChIKey |
KFEFLPDKISUVNR-NEVRIAIQNA-N |
| InChICode |
InChI=1S/C29H36O16/c30-11-19-22(37)23(38)24(39)29(42-19)45-27-25(40)28(41-8-7-14-2-5-16(33)18(35)10-14)43-20(12-31)26(27)44-21(36)6-3-13-1-4-15(32)17(34)9-13/h1-6,9-10,19-20,22-35,37-40H,7-8,11-12H2/b6-3+/t19-,20-,22+,23-,24-,25+,26+,27+,28+,29-/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C(CO)O[C@@H](OCCc2ccc(O)c(O)c2)C(O)[C@H]1O[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Digitalis purpurea  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza scrophulariiflora  | Ref. |
| Plantae | Plantaginaceae | Plantago arborescens | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Plantago ovata  | Ref. |
| Plantae | Plantaginaceae | Plantago webbii | Ref. |
| Plantae | Plantaginaceae | Veronica beccabunga  | Ref. |
| Plantae | Plantaginaceae | Wulfenia baldaccii Degen | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
|
|
zoom in
| Organism | Veronica beccabunga | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|