| Name |
Apiol Parsley apiole Apiole |
| Formula |
C12H14O4 |
| Mw |
222.08920894 |
| CAS RN |
523-80-8 |
| C_ID |
C00002714
, 
|
| InChIKey |
QQRSPHJOOXUALR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H14O4/c1-4-5-8-6-9(13-2)11-12(10(8)14-3)16-7-15-11/h4,6H,1,5,7H2,2-3H3 |
| SMILES |
C=CCc1cc(OC)c2c(c1OC)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Chromalveolata | Dictyotaceae | Spatoglossum variabile | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Anethum graveolens  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Crithmum maritimum  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Heracleum pyrenaicum | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Ocotea spp. | Ref. |
| Plantae | Lauraceae | Sassafras albidum  | Ref. |
| Plantae | Piperaceae | Piper angustifolium | Ref. |
| Plantae | Piperaceae | Piper brachystachyum | Ref. |
| Plantae | Piperaceae | Piper lhotzkyanum | Ref. |
| Plantae | Piperaceae | Piper marginatum  | Ref. |
| Plantae | Piperaceae | Piper regnellii  | Ref. |
| Plantae | Piperaceae | Piper solmsianum | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
| Plantae | Zingiberaceae | Zingiber cassumunar Roxb.  | Ref. |
|
|
zoom in
| Organism | Stellaria pallida | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|