| Name |
4-Methylphenol p-Cresol |
| Formula |
C7H8O |
| Mw |
108.05751488 |
| CAS RN |
106-44-5 |
| C_ID |
C00002645
, 
|
| InChIKey |
IWDCLRJOBJJRNH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3 |
| SMILES |
Cc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Feces) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Pimpinella anisum  | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Meliaceae | Melia azadirach | Ref. |
| Plantae | Moraceae | Morus spp. | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Poaceae | Sasa albo-marginata | Ref. |
| Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Campylobacter jejuni | Ref. |
| - | - | Clostridium difficile | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|