| Name |
(-)-Licarin A Licarin A |
| Formula |
C20H22O4 |
| Mw |
326.15180919 |
| CAS RN |
51020-86-1 |
| C_ID |
C00002611
, 
|
| InChIKey |
ITDOFWOJEDZPCF-SLKIJPOUNA-N |
| InChICode |
InChI=1S/C20H22O4/c1-5-6-13-9-15-12(2)19(24-20(15)18(10-13)23-4)14-7-8-16(21)17(11-14)22-3/h5-12,19,21H,1-4H3/b6-5+/t12-,19-/m0/s1 |
| SMILES |
C/C=C/c1cc(OC)c2c(c1)[C@H](C)[C@@H](c1ccc(O)c(OC)c1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aristolochiaceae | Aristolochia maxima  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia pubescens | Ref. |
| Plantae | Aristolochiaceae | Aristolochia taliscana | Ref. |
| Plantae | Lauraceae | Licaria aritu | Ref. |
| Plantae | Lauraceae | Machilus japonica | Ref. |
| Plantae | Lauraceae | Machilus odoratissima NEES | Ref. |
| Plantae | Lauraceae | Machilus thunbergii  | Ref. |
| Plantae | Linderniaceae | Micranthemum umbrosum | Ref. |
| Plantae | Myristicaceae | Myristica fragrans  | Ref. |
| - | - | Jackiella javanica | Ref. |
|
|
zoom in
| Organism | Myristica fragrans | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Liu, et al., Planta Med, 70, (2004), 458 |
|---|
|