| Name |
(-)-Glyceollin I |
| Formula |
C20H18O5 |
| Mw |
338.11542369 |
| CAS RN |
57103-57-8 |
| C_ID |
C00002530
, 
|
| InChIKey |
YIFYYPKWOQSCRI-HOFUVJEBNA-N |
| InChICode |
InChI=1S/C20H18O5/c1-19(2)8-7-12-15(25-19)6-4-13-17(12)23-10-20(22)14-5-3-11(21)9-16(14)24-18(13)20/h3-9,18,21-22H,10H2,1-2H3/t18-,20+/m0/s1 |
| SMILES |
CC1(C)C=Cc2c(ccc3c2OC[C@@]2(O)c4ccc(O)cc4O[C@@H]32)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycine clandestina | Ref. |
| Plantae | Fabaceae | Glycine falcata | Ref. |
| Plantae | Fabaceae | Glycine latifolia | Ref. |
| Plantae | Fabaceae | Glycine latrobeana | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycine soja  | Ref. |
| Plantae | Fabaceae | Glycine tabacina | Ref. |
| Plantae | Fabaceae | Glycine tomentella | Ref. |
| Plantae | Fabaceae | Psoralea acaulis | Ref. |
| Plantae | Fabaceae | Psoralea bituminosa  | Ref. |
| Plantae | Fabaceae | Psoralea onobrychis | Ref. |
|
|
zoom in
| Organism | Psoralea acaulis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Burden,Phytochem.,14,(1975),1389
Lyne,J.Chem.Soc.Chem.Commun.,(1976),497 |
|---|
|