| Name |
Fraxin |
| Formula |
C16H18O10 |
| Mw |
370.0899968 |
| CAS RN |
524-30-1 |
| C_ID |
C00002474
, 
|
| InChIKey |
CRSFLLTWRCYNNX-QNESIFLZNA-N |
| InChICode |
InChI=1S/C16H18O10/c1-23-7-4-6-2-3-9(18)25-14(6)15(11(7)20)26-16-13(22)12(21)10(19)8(5-17)24-16/h2-4,8,10,12-13,16-17,19-22H,5H2,1H3/t8-,10-,12+,13-,16+/m1/s1 |
| SMILES |
COc1cc2ccc(=O)oc2c(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Calycanthaceae | Chimonanthus fragrans | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula spp. | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Diervillaceae | Diervilla spp. | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Symphoricarpos spp. | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Malvaceae | Tilia spp.  | Ref. |
| Plantae | Oleaceae | Fraxinus bungeana | Ref. |
| Plantae | Oleaceae | Fraxinus excelsior  | Ref. |
| Plantae | Oleaceae | Fraxinus japonica Seringe Blume  | Ref. |
| Plantae | Oleaceae | Fraxinus ornus  | Ref. |
| Plantae | Oleaceae | Fraxinus paxiana | Ref. |
| Plantae | Oleaceae | Fraxinus potamophila | Ref. |
| Plantae | Oleaceae | Fraxinus spp. | Ref. |
| Plantae | Oleaceae | Fraxinus stylosa  | Ref. |
| Plantae | Oleaceae | Fraxinus szaboana  | Ref. |
| Plantae | Sapindaceae | Acer nikoense  | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Fraxinus excelsior | | Reference | Chang, et al., Dictionary of Chemistry, Science Press, Beijing, (2008).
MORIKAWA, et al., Chem Pharm Bull, 51, (2003), 62.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|