| Name |
Cyanidin 3,5,3'-triglucoside |
| Formula |
C33H41O21 |
| Mw |
773.21403338 |
| CAS RN |
88110-66-1 |
| C_ID |
C00002377
, 
|
| InChIKey |
ZOEXTKFPTHFWDY-BNWNPYSZNA-O |
| InChICode |
InChI=1S/C33H40O21/c34-7-18-21(39)24(42)27(45)31(52-18)49-15-5-11(37)4-14-12(15)6-17(51-33-29(47)26(44)23(41)20(9-36)54-33)30(48-14)10-1-2-13(38)16(3-10)50-32-28(46)25(43)22(40)19(8-35)53-32/h1-6,18-29,31-36,39-47H,7-9H2,(H-,37,38)/p+1/t18-,19+,20-,21-,22-,23-,24+,25+,26-,27-,28-,29+,31-,32+,33-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)cc3[o+]c2-c2ccc(O)c(O[C@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bromeliaceae | Aechmea spp. | Ref. |
| Plantae | Bromeliaceae | Ananas comosus  | Ref. |
| Plantae | Bromeliaceae | Billbergia buchholtzii | Ref. |
| Plantae | Bromeliaceae | Canistrum cyathiforme | Ref. |
| Plantae | Bromeliaceae | Cryptanthus spp. | Ref. |
| Plantae | Bromeliaceae | Fascicularia kirchoffiana | Ref. |
| Plantae | Bromeliaceae | Neoregelia spp. | Ref. |
| Plantae | Bromeliaceae | Nidularium spp. | Ref. |
| Plantae | Bromeliaceae | Pitcairnia tabuliformis | Ref. |
| Plantae | Bromeliaceae | Streptocalyx poeppigii | Ref. |
|
|
zoom in
| Organism | Pitcairnia tabuliformis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Saito,Phytochem.,22,(1983),1735 |
|---|
|