| Name |
Questin Methylemodine |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
3774-64-9 |
| C_ID |
C00000570
, 
|
| InChIKey |
UUNPIWCQMVNINR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-7-3-9-13(11(18)4-7)16(20)14-10(15(9)19)5-8(17)6-12(14)21-2/h3-6,17-18H,1-2H3 |
| SMILES |
COc1cc(O)cc2c1C(=O)c1c(O)cc(C)cc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Microascaceae | Microascus tardifaciens | Ref. |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Fungi | Trichocomaceae | Aspergillus terreus IMI16043  | Ref. |
| Plantae | Fabaceae | Senna didymobotrya  | Ref. |
| Plantae | Fabaceae | Senna obtusifolia  | Ref. |
| Plantae | Fabaceae | Senna occidentalis  | Ref. |
| Plantae | Fabaceae | Senna sophera  | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum multiflorum  | Ref. |
| Plantae | Polygonaceae | Rumex patientia  | Ref. |
| Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
|
|
zoom in
| Organism | Polygonum multiflorum | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|