| Name |
Xenognosin B 2'-Hydroxyformononetin 7,2'-Dihydroxy-4'-methoxyisoflavone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
1890-99-9 |
| C_ID |
C00000257
, 
|
| InChIKey |
XKHHKXCBFHUOHM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-10-3-5-11(14(18)7-10)13-8-21-15-6-9(17)2-4-12(15)16(13)19/h2-8,17-18H,1H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)ccc3c2=O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Actinostolidae | Pycnanthus angolensis  | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Myristicaceae | Virola cadudifolia | Ref. |
| Plantae | Myristicaceae | Virola multinervia | Ref. |
| Plantae | Orobanchaceae | Agalinis purpurea | Ref. |
|
|
zoom in
| Organism | Virola multinervia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoidsBraz Filho,Lloydia,40,(1977),236 |
|---|
|