| Name |
5-Hydroxy-1,4-naphthoquinone juglone Juglone |
| Formula |
C10H6O3 |
| Mw |
174.03169406 |
| CAS RN |
481-39-0 |
| C_ID |
C00000144
, 
|
| InChIKey |
KQPYUDDGWXQXHS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H6O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-5,12H |
| SMILES |
O=C1C=CC(=O)c2c(O)cccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Astragalus alopecurus | Ref. |
| Plantae | Juglandaceae | Carya illinoensis | Ref. |
| Plantae | Juglandaceae | Carya ovata | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Juglandaceae | Juglans nigra  | Ref. |
| Plantae | Juglandaceae | Juglans regia  | Ref. |
| Plantae | Juglandaceae | Juglans spp | Ref. |
| Plantae | Juglandaceae | Juglans spp.  | Ref. |
| Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
| Plantae | Proteaceae | Lomatia spp. | Ref. |
|
|
zoom in
| Organism | Platycarya strobilacea | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
HIGA, et al., Chem Pharm Bull, 50, (2002), 590 |
|---|
|