| Name |
Vanillin |
| Formula |
C8H8O3 |
| Mw |
152.04734412 |
| CAS RN |
5463-22-9 |
| C_ID |
C00002683
, 
|
| InChIKey |
MWOOGOJBHIARFG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 |
| SMILES |
COc1cc(C=O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anacardiaceae | Rhus semialata  | Ref. |
| Plantae | Annonaceae | Annona purpurea  | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Chaerophyllum hirsutum | Ref. |
| Plantae | Apiaceae | Conioselinum vaginatum | Ref. |
| Plantae | Apiaceae | Ferula assa-foetida  | Ref. |
| Plantae | Apiaceae | Ligusticum chuanxiung | Ref. |
| Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia pubescens | Ref. |
| Plantae | Asparagaceae | Asparagus cochinchinensis  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asparagaceae | Asparagus racemosus  | Ref. |
| Plantae | Asparagaceae | Asparagus spp.  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Dahlia spp. | Ref. |
| Plantae | Asteraceae | Gynura elliptica | Ref. |
| Plantae | Asteraceae | Gynura segetum | Ref. |
| Plantae | Asteraceae | Ligularia dentata Hara | Ref. |
| Plantae | Asteraceae | Ligularia stenocephala Matsum.et Koidz. | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caryophyllales | Beta spp. | Ref. |
| Plantae | Celastraceae | Microtropis japonica | Ref. |
| Plantae | Convallariaceae | Tupistra chinensis | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Equisetaceae | Equisetum hiemale | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Hamamelidaceae | Liquidambar orientalis  | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Hypoxidaceae | Curculigo capitulata | Ref. |
| Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Vitex trifolia  | Ref. |
| Plantae | Lauraceae | Beilschmiedia erythrophloia | Ref. |
| Plantae | Lauraceae | Cassytha filiformis  | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lauraceae | Phoebe formosana | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Myrtaceae | Pimenta dioica  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Orchidaceae | Gastrodia elata  | Ref. |
| Plantae | Orchidaceae | Gymnadenia spp. | Ref. |
| Plantae | Orchidaceae | Vanilla planifolia  | Ref. |
| Plantae | Orchidaceae | Vanilla spp. | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus oligospermus | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays L.  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rosaceae | Spiraea spp. | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus limonia  | Ref. |
| Plantae | Rutaceae | Ruta spp. | Ref. |
| Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
| Plantae | Santalaceae | Viscum articulactum | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Styracaceae | Styrax benzoin  | Ref. |
| Plantae | Taxaceae | Taxus mairei  | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Ulva pertusa | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|