| Name |
Biochanin A Pratensol Olmelin Genistein 4'-methyl ether 5,7-Dihydroxy-4'-methoxyisoflavone Biochanin |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
491-80-5 |
| C_ID |
C00002510
, 
|
| InChIKey |
WUADCCWRTIWANL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-11-4-2-9(3-5-11)12-8-21-14-7-10(17)6-13(18)15(14)16(12)19/h2-8,17-18H,1H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)cc(O)c3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Fabaceae | Albizia procera  | Ref. |
| Plantae | Fabaceae | Andira inermis  | Ref. |
| Plantae | Fabaceae | Andira parviflora | Ref. |
| Plantae | Fabaceae | Baptisia alba | Ref. |
| Plantae | Fabaceae | Baptisia calycosa | Ref. |
| Plantae | Fabaceae | Baptisia sphaerocarpa | Ref. |
| Plantae | Fabaceae | Baptisia tinctoria  | Ref. |
| Plantae | Fabaceae | Bolusanthus specious | Ref. |
| Plantae | Fabaceae | Cicer anatolicum | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Cicer bijugum | Ref. |
| Plantae | Fabaceae | Cicer canariensis | Ref. |
| Plantae | Fabaceae | Cicer chorassanicum | Ref. |
| Plantae | Fabaceae | Cicer cuneatum | Ref. |
| Plantae | Fabaceae | Cicer echinospermum | Ref. |
| Plantae | Fabaceae | Cicer judaicum | Ref. |
| Plantae | Fabaceae | Cicer judicum | Ref. |
| Plantae | Fabaceae | Cicer macracanthum | Ref. |
| Plantae | Fabaceae | Cicer microphyllum | Ref. |
| Plantae | Fabaceae | Cicer mogolatvicum | Ref. |
| Plantae | Fabaceae | Cicer montbretii | Ref. |
| Plantae | Fabaceae | Cicer nuristanicum | Ref. |
| Plantae | Fabaceae | Cicer oxyodon | Ref. |
| Plantae | Fabaceae | Cicer pinnatifidum | Ref. |
| Plantae | Fabaceae | Cicer pungens | Ref. |
| Plantae | Fabaceae | Cicer rechingeri | Ref. |
| Plantae | Fabaceae | Cicer reticulatum | Ref. |
| Plantae | Fabaceae | Cicer songaricum | Ref. |
| Plantae | Fabaceae | Cicer yamashitae | Ref. |
| Plantae | Fabaceae | Dalbergia lanceolaria  | Ref. |
| Plantae | Fabaceae | Dalbergia nitidula  | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia parviflora  | Ref. |
| Plantae | Fabaceae | Dalbergia spruceana | Ref. |
| Plantae | Fabaceae | Dalbergia volubilis  | Ref. |
| Plantae | Fabaceae | Echinospartum horridum | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Haplormosia monophylla | Ref. |
| Plantae | Fabaceae | Hedysarum multijugum | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Millettia dielsiana | Ref. |
| Plantae | Fabaceae | Myroxylon peruiferum  | Ref. |
| Plantae | Fabaceae | Ononis spinosa  | Ref. |
| Plantae | Fabaceae | Pericopsis elata  | Ref. |
| Plantae | Fabaceae | Pericopsis laxiflora  | Ref. |
| Plantae | Fabaceae | Pericopsis mooniana | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Sophora mollis  | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Swartzia polyphylla | Ref. |
| Plantae | Fabaceae | Thermopsis macrophylla | Ref. |
| Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
| Plantae | Fabaceae | Trifolium alpestre | Ref. |
| Plantae | Fabaceae | Trifolium apertum | Ref. |
| Plantae | Fabaceae | Trifolium canescens | Ref. |
| Plantae | Fabaceae | Trifolium caucasicum | Ref. |
| Plantae | Fabaceae | Trifolium incarnatum | Ref. |
| Plantae | Fabaceae | Trifolium medium | Ref. |
| Plantae | Fabaceae | Trifolium pannonicum  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium repensl | Ref. |
| Plantae | Fabaceae | Trifolium riograndense | Ref. |
| Plantae | Fabaceae | Trifolium trichocephalum | Ref. |
| Plantae | Fabaceae | Wisteria brachybotrys | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Myristicaceae | Virola caducifolia | Ref. |
| Plantae | Myristicaceae | Virola cadudifolia | Ref. |
| Plantae | Myristicaceae | Virola surinamensis  | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Gynerium sagittatum  | Ref. |
| Plantae | Podocarpaceae | Podocarpus amarus | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| - | - | Halotydeus destructor | Ref. |
| - | - | Moghania philippinensis | Ref. |
|
|
zoom in
| Organism | Trifolium riograndense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|