| Name |
Morroniside |
| Formula |
C17H26O11 |
| Mw |
406.14751167 |
| CAS RN |
25406-64-8 |
| C_ID |
C00037513
, 
|
| InChIKey |
YTZSBJLNMIQROD-TUXGYAPPNA-N |
| InChICode |
InChI=1S/C17H26O11/c1-6-11-7(3-10(19)26-6)8(15(23)24-2)5-25-16(11)28-17-14(22)13(21)12(20)9(4-18)27-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9+,10+,11+,12+,13-,14+,16-,17-/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2[C@H](C)O[C@@H](O)C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica Thunb.  | Ref. |
| Plantae | -- | Lonicera morrowii | Ref. |
| Plantae | Adoxaceae | Adoxa moschatellina | Ref. |
| Plantae | Caprifoliaceae | Patrinia villosa | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
| Plantae | Gentianaceae | Gentiana straminea | Ref. |
| Plantae | Gentianaceae | Gentiana thunbergii | Ref. |
| Plantae | Gentianaceae | Tripterospermum japonicum | Ref. |
| Plantae | Rutaceae | Phellodendron amurense | Ref. |
|
|
zoom in
| Organism | Tripterospermum japonicum |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
OTSUKA, et al., Chem Pharm Bull, 49, (2001), 699 |
|---|
|
