| Name |
Elliptinone |
| Formula |
C22H14O6 |
| Mw |
374.07903818 |
| CAS RN |
20175-85-3 |
| C_ID |
C00032936
, 
|
| InChIKey |
TXVAHWOABLOYCD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H14O6/c1-9-7-15(23)17-13(19(9)25)5-3-11(21(17)27)12-4-6-14-18(22(12)28)16(24)8-10(2)20(14)26/h3-8,27-28H,1-2H3 |
| SMILES |
CC1=CC(=O)c2c(ccc(-c3ccc4c(c3O)C(=O)C=C(C)C4=O)c2O)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ebenaceae | Diospyros elliptifolia | Ref. |
| Plantae | Ebenaceae | Diospyros maritima BLUME  | Ref. |
| Plantae | Ebenaceae | Diospyros mollis  | Ref. |
| Plantae | Ebenaceae | Diospyros samoensis  | Ref. |
| Plantae | Ebenaceae | Diospyros siamang | Ref. |
| Plantae | Ebenaceae | Diospyros walkeri | Ref. |
| Plantae | Ebenaceae | Diospyros wallichii | Ref. |
| Plantae | Plumbaginaceae | Plumbago indica  | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
|
|
zoom in
| Organism | Plumbago indica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|