| Name |
cis-beta-Terpineol (Z)-beta-Terpineol |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
7299-40-3 |
| C_ID |
C00029352
, 
|
| InChIKey |
RUJPNZNXGCHGID-MGCOHNPYNA-N |
| InChICode |
InChI=1S/C10H18O/c1-8(2)9-4-6-10(3,11)7-5-9/h9,11H,1,4-7H2,2-3H3/t9-,10+ |
| SMILES |
C=C(C)[C@H]1CC[C@](C)(O)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Saururaceae | Houttuynia sp. | Ref. |
|
|
zoom in
| Organism | Rosmarinus officinalis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|