| Name |
Corypalmine (-)-Corypalmine |
| Formula |
C20H23NO4 |
| Mw |
341.16270823 |
| CAS RN |
6018-40-2 |
| C_ID |
C00026088
, 
|
| InChIKey |
BMCZTYDZHNTKPR-XISACWJONA-N |
| InChICode |
InChI=1S/C20H23NO4/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,9-10,16,22H,6-8,11H2,1-3H3/t16-/m0/s1 |
| SMILES |
COc1cc2c(cc1O)CCN1Cc3c(ccc(OC)c3OC)C[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimolia | Ref. |
| Plantae | Annonaceae | Guatteria discolor | Ref. |
| Plantae | Annonaceae | Pachypodanthium staudtii Engl.& Diels  | Ref. |
| Plantae | Annonaceae | Xylopia discreta  | Ref. |
| Plantae | Annonaceae | Xylopia vieillardi | Ref. |
| Plantae | Berberidaceae | Mahonia aquifolium Nutt. | Ref. |
| Plantae | Fumariaceae | Corydalis cava (L.) Schw.et Koert  | Ref. |
| Plantae | Fumariaceae | Corydalis chaerophylla  | Ref. |
| Plantae | Fumariaceae | Corydalis incisa Pers. | Ref. |
| Plantae | Fumariaceae | Corydalis lutea | Ref. |
| Plantae | Fumariaceae | Corydalis nobilis | Ref. |
| Plantae | Fumariaceae | Corydalis ophiocarpa Thoms | Ref. |
| Plantae | Fumariaceae | Corydalis thalictrifolia Franch | Ref. |
| Plantae | Fumariaceae | Dicentra oregana Eastwood. | Ref. |
| Plantae | Menispermaceae | Stephania micrantha H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania officinarum | Ref. |
| Plantae | Menispermaceae | Stephania succinifera H.S.Lo | Ref. |
| Plantae | Ranunculaceae | Thalictrum minus | Ref. |
| Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis L.  | Ref. |
|
|
zoom in
| Organism | Corydalis chaerophylla | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|