| Name |
(-)-Curine (-)-Bebeerine Aristolochine Aristolochine(C36 alkaloid) l-Bebeerine l-Curine L-Bebeerine |
| Formula |
C36H38N2O6 |
| Mw |
594.27298696 |
| CAS RN |
436-05-5 |
| C_ID |
C00025602
, 
|
| InChIKey |
NGZXDRGWBULKFA-LEFKRGDZNA-N |
| InChICode |
InChI=1S/C36H38N2O6/c1-37-13-11-23-18-31(41-3)32-20-26(23)27(37)15-21-5-8-25(9-6-21)43-36-34-24(19-33(42-4)35(36)40)12-14-38(2)28(34)16-22-7-10-29(39)30(17-22)44-32/h5-10,17-20,27-28,39-40H,11-16H2,1-4H3/t27-,28-/m1/s1 |
| SMILES |
COc1cc2c3cc1Oc1cc(ccc1O)C[C@@H]1c4c(cc(OC)c(O)c4Oc4ccc(cc4)C[C@H]3N(C)CC2)CCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Isolona ghesquireina | Ref. |
| Plantae | Aristolochiaceae | Aristolochia argentina Gris.  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia clematis L. | Ref. |
| Plantae | Aristolochiaceae | Aristolochia debilis  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia indica L.  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia rotunda  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia silpho | Ref. |
| Plantae | Buxaceae | Buxus sempervirens  | Ref. |
| Plantae | Menispermaceae | Chondrodendron tomentosum | Ref. |
| Plantae | Menispermaceae | Cissampelos pareira L.  | Ref. |
| Plantae | Menispermaceae | Curarea toxicoferum Barneby & Kurkoff | Ref. |
| Plantae | Menispermaceae | Cyclea barbata Miers  | Ref. |
| Plantae | Menispermaceae | Cyclea hainanensis Merr. | Ref. |
| Plantae | Menispermaceae | Cyclea hypoglauca Diels | Ref. |
| Plantae | Menispermaceae | Cyclea peltata Diels  | Ref. |
| Plantae | Menispermaceae | Cyclea tonkinensis Gagnep. | Ref. |
| Plantae | Menispermaceae | Stephania brachyandra Diels | Ref. |
| Plantae | Menispermaceae | Stephania epigaea H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania excentrica H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania mashanica H.S.Lo & B.N. | Ref. |
| Plantae | Menispermaceae | Stephania micrantha H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania tetrandra S.Moore  | Ref. |
| - | - | Chondodendron platyphyllum (A.St.Hil) Miers | Ref. |
| - | - | Chondodendron tomentosum Ruiz & Pavon  | Ref. |
| - | - | Chondodendron toxicoferum (Wedd.) Krukoff & Moldenke | Ref. |
| - | - | Radix pareira brava | Ref. |
|
|
zoom in
| Organism | Buxus sempervirens | | Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|