| Name |
(-)-9-Aristolene Aristolene (-)-Aristolene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
6831-16-9 |
| C_ID |
C00017471
, 
|
| InChIKey |
FOBXOZMHEKILEY-ZEYTXOKVNA-N |
| InChICode |
InChI=1S/C15H24/c1-10-6-5-7-11-8-9-12-13(14(12,2)3)15(10,11)4/h8,10,12-13H,5-7,9H2,1-4H3/t10-,12-,13+,15+/m1/s1 |
| SMILES |
C[C@@H]1CCCC2=CC[C@@H]3[C@@H](C3(C)C)[C@]21C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Calypogeia | Calypogeia suecica | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Valerianaceae | Nardostachys chinensis  | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamansi  | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|