| Name |
(+)-Ampelopsin A Ampelopsin A |
| Formula |
C28H22O7 |
| Mw |
470.13655306 |
| CAS RN |
130608-11-6 |
| C_ID |
C00015736
, 
|
| InChIKey |
LHUHHURKGTUZHU-YDENDRJONA-N |
| InChICode |
InChI=1S/C28H22O7/c29-15-5-1-13(2-6-15)23-24-19(9-17(31)11-21(24)33)26-25-20(27(23)34)10-18(32)12-22(25)35-28(26)14-3-7-16(30)8-4-14/h1-12,23,26-34H/t23-,26-,27-,28+/m0/s1 |
| SMILES |
Oc1ccc([C@H]2c3c(O)cc(O)cc3[C@H]3c4c(cc(O)cc4[C@@H]2O)O[C@@H]3c2ccc(O)cc2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dipterocarpaceae | Hopea utilis | Ref. |
| Plantae | Vitaceae | Ampelopsis brevipedunculata var hancei  | Ref. |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis betulifolia | Ref. |
| Plantae | Vitaceae | Vitis chunganensis | Ref. |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis heyneana | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis thunbergii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|