| Name |
Festuclavin Festuclavine |
| Formula |
C16H20N2 |
| Mw |
240.16264865 |
| CAS RN |
569-26-6 |
| C_ID |
C00011209
, 
|
| InChIKey |
VLMZMRDOMOGGFA-SPHRCPJVNA-N |
| InChICode |
InChI=1S/C16H20N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-5,8,10,13,15,17H,6-7,9H2,1-2H3/t10-,13-,15-/m1/s1 |
| SMILES |
C[C@@H]1C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Clavicipitaceae | Claviceps africana | Ref. |
| Fungi | Clavicipitaceae | Claviceps gigontea | Ref. |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Fungi | Trichocomaceae | Neosartorya fumigata | Ref. |
| Fungi | Trichocomaceae | Penicillium chermesinum | Ref. |
| Fungi | Trichocomaceae | Penicillium commune | Ref. |
| Plantae | Convolvulaceae | Argyreia nervosa  | Ref. |
| Plantae | Poaceae | Festuca rubra  | Ref. |
| Plantae | Poaceae | Trisetum bifidum Ohwi | Ref. |
| - | - | Agropyrum semicostatum | Ref. |
| - | - | Aspergullus fumigatus | Ref. |
| - | - | Neosartarya fumigata Af293 | Ref. |
|
|
zoom in
| Organism | Festuca rubra | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Berde,Handbook of Experimental Pharmacology,Springer-Verlag New York,(1978) |
|---|
|