| Name |
Piperitenone p-Mentha-1,4(8)-dien-3-one Pulespenone 3-Terpinolenone |
| Formula |
C10H14O |
| Mw |
150.10446507 |
| CAS RN |
491-09-8 |
| C_ID |
C00010889
, 
|
| InChIKey |
HKZQJZIFODOLFR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)6-10(9)11/h6H,4-5H2,1-3H3 |
| SMILES |
CC1=CC(=O)C(=C(C)C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Mentha arvensis L.  | Ref. |
| Plantae | Labiatae | Mentha pulegium  | Ref. |
| Plantae | Labiatae | Mentha spp.  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Schizonepeta tenuifolia  | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta subsp.glandulosa.  | Ref. |
| Plantae | Poaceae | Cymbopogon martinii  | Ref. |
| Plantae | Verbenaceae | Lippia spp. | Ref. |
|
|
zoom in
| Organism | Schizonepeta tenuifolia | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|