| Name |
Ajugoside |
| Formula |
C17H26O10 |
| Mw |
390.15259705 |
| CAS RN |
52916-96-8 |
| C_ID |
C00010601
, 
|
| InChIKey |
FLOXQRMTDDOZKF-MPCPGHGCNA-N |
| InChICode |
InChI=1S/C17H26O10/c1-7(19)27-17(2)5-9(20)8-3-4-24-15(11(8)17)26-16-14(23)13(22)12(21)10(6-18)25-16/h3-4,8-16,18,20-23H,5-6H2,1-2H3/t8-,9-,10+,11-,12-,13-,14+,15+,16?,17+/m1/s1 |
| SMILES |
CC(=O)O[C@@]1(C)C[C@@H](O)[C@@H]2C=CO[C@@H](O[C@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Labiatae | Ajuga reptans  | Ref. |
| Plantae | Labiatae | Clerodendrum thomsonae | Ref. |
| Plantae | Labiatae | Leonurus cardiaca  | Ref. |
| Plantae | Labiatae | Leonurus persicus | Ref. |
| Plantae | Labiatae | Melittis melissophyllum  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia deserti  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia lepidota | Ref. |
|
|
zoom in
| Organism | Scrophularia dentata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|