| Name |
(-)-Medicocarpin Medicarpin 3-O-beta-D-glucoside Medicarpin 3-O-glucoside Medicarpin-3-O-glucoside |
| Formula |
C22H24O9 |
| Mw |
432.14203237 |
| CAS RN |
52766-70-8 |
| C_ID |
C00010183
, 
|
| InChIKey |
PVEMGMOWXQUWRD-RGMGFVNCNA-N |
| InChICode |
InChI=1S/C22H24O9/c1-27-10-2-4-12-14-9-28-15-7-11(3-5-13(15)21(14)30-16(12)6-10)29-22-20(26)19(25)18(24)17(8-23)31-22/h2-7,14,17-26H,8-9H2,1H3/t14-,17-,18-,19-,20+,21-,22+/m0/s1 |
| SMILES |
COc1ccc2c(c1)OC1c3ccc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc3OCC21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza kansuensis | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Ononis spinosa  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium spp. | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Trifolium spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Sakagami,Agric.Biol.Chem.,38,(1974),1031
Kessmann,Plant Physiol.,94,(1990),227 |
|---|
|