| Name |
Lupiwighteone 5,7,4'-Trihydroxy-8-prenylisoflavone |
| Formula |
C20H18O5 |
| Mw |
338.11542369 |
| CAS RN |
104691-86-3 |
| C_ID |
C00009896
, 
|
| InChIKey |
YGCCASGFIOIXIN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17(23)18-19(24)15(10-25-20(14)18)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c(=O)c(-c3ccc(O)cc3)coc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Erythrina variegata L.  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lupinus luteus  | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Vigna angularis  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
|
|
zoom in
| Organism | Vigna angularis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Hashidoko,Agric.Biol.Chem.,50,(1986),1797
Abe,Agric.Biol.Chem.,51,(1987),349 |
|---|
|