| Name |
Dehydrorotenone Didehydrorotenone 6a,12a-Dehydrorotenone |
| Formula |
C23H20O6 |
| Mw |
392.12598837 |
| CAS RN |
3466-09-9 |
| C_ID |
C00009602
, 
|
| InChIKey |
GFERNZCCTZEIET-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C23H20O6/c1-11(2)16-8-14-15(28-16)6-5-12-22(24)21-13-7-18(25-3)19(26-4)9-17(13)27-10-20(21)29-23(12)14/h5-7,9,16H,1,8,10H2,2-4H3/t16-/m0/s1 |
| SMILES |
C=C(C)C1Cc2c(ccc3c(=O)c4c(oc23)COc2cc(OC)c(OC)cc2-4)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Derris malaccensis | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Lonchocarpus longifolius | Ref. |
| Plantae | Fabaceae | Millettia pachycarpa | Ref. |
| Plantae | Fabaceae | Neorautanenia amboensis | Ref. |
| Plantae | Fabaceae | Tephrosia candida | Ref. |
| Plantae | Fabaceae | Tephrosia falciformis | Ref. |
| Plantae | Fabaceae | Tephrosia virginiana | Ref. |
|
|
zoom in
| Organism | Tephrosia virginiana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Bose,Indian J.Chem.Sect.B,14,(1976),1012
Clark,J.Am.Chem.Soc.,65,(1943),27 |
|---|
|