| Name |
Dehydrodeguelin 6a,12a-Dehydrodeguelin |
| Formula |
C23H20O6 |
| Mw |
392.12598837 |
| CAS RN |
3466-23-7 |
| C_ID |
C00009601
, 
|
| InChIKey |
NGQVFILFHVPLFE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C23H20O6/c1-23(2)8-7-12-15(29-23)6-5-13-21(24)20-14-9-17(25-3)18(26-4)10-16(14)27-11-19(20)28-22(12)13/h5-10H,11H2,1-4H3 |
| SMILES |
COc1cc2c(cc1OC)-c1c(oc3c4c(ccc3c1=O)OC(C)(C)C=C4)CO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Amorpha fruticosa | Ref. |
| Plantae | Fabaceae | Derris elliptica  | Ref. |
| Plantae | Fabaceae | Derris malaccensis | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Millettia duchesnei | Ref. |
| Plantae | Fabaceae | Millettia dura | Ref. |
| Plantae | Fabaceae | Millettia oblata ssp. teitensis  | Ref. |
| Plantae | Fabaceae | Tephrosia candida | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| Plantae | Fabaceae | Tephrosia vogelii  | Ref. |
|
|
zoom in
| Organism | Tephrosia candida | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Clark,J.Am.Chem.Soc.,55,(1933),422
Delfel,J.Assoc.Off.Anal.Chem.,52,(1969),182 |
|---|
|