| Name |
Milldurone 6,7,2'-Trimethoxy-4',5'-methylenedioxyisoflavone |
| Formula |
C19H16O7 |
| Mw |
356.08960287 |
| CAS RN |
24195-15-1 |
| C_ID |
C00009421
, 
|
| InChIKey |
INHRJYBOMHQVBR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H16O7/c1-21-13-6-18-17(25-9-26-18)4-10(13)12-8-24-14-7-16(23-3)15(22-2)5-11(14)19(12)20/h4-8H,9H2,1-3H3 |
| SMILES |
COc1cc2occ(-c3cc4c(cc3OC)OCO4)c(=O)c2cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Cordia africana  | Ref. |
| Plantae | Fabaceae | Ateleia herbert-smithii | Ref. |
| Plantae | Fabaceae | Dalbergia paniculata  | Ref. |
| Plantae | Fabaceae | Mildbraediodendron excelsum | Ref. |
| Plantae | Fabaceae | Millettia dura | Ref. |
| Plantae | Fabaceae | Millettia oblata ssp. teitensis  | Ref. |
| Plantae | Fabaceae | Millettia pachyloba | Ref. |
| Plantae | Fabaceae | Pterodon apparicioi | Ref. |
| Plantae | Fabaceae | Pterodon pubescens | Ref. |
|
|
zoom in
| Organism | Pterodon apparicioi | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Meegan,Phytochem.,14,(1975),2283
Galina,Phytochem.,13,(1974),2593 |
|---|
|