| Name |
3'-Hydroxydaidzein 7,3',4'-Trihydroxyisoflavone |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
485-63-2 |
| C_ID |
C00009384
, 
|
| InChIKey |
DDKGKOOLFLYZDL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-9-2-3-10-14(6-9)20-7-11(15(10)19)8-1-4-12(17)13(18)5-8/h1-7,16-18H |
| SMILES |
O=c1c(-c2ccc(O)c(O)c2)coc2cc(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Streptomycetaceae | Streptomyces sp. OH-1049 | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Machaerium villosum | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Muntingiaceae | Muntingia calabura  | Ref. |
|
|
zoom in
| Organism | Machaerium villosum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Braga de Oliveira,An.Acad.Brasil.Cienc.,40,(1968),147 |
|---|
|