| Name |
Prodelphinidin B3 Gallocatechin-(4alpha->8)-gallocatechin |
| Formula |
C30H26O14 |
| Mw |
610.13225554 |
| CAS RN |
110115-59-8 |
| C_ID |
C00009116
, 
|
| InChIKey |
RTEDIEITOBJPNI-AHAMITCENA-N |
| InChICode |
InChI=1S/C30H26O14/c31-11-5-14(33)22-21(6-11)43-29(10-3-18(37)26(41)19(38)4-10)27(42)24(22)23-15(34)8-13(32)12-7-20(39)28(44-30(12)23)9-1-16(35)25(40)17(36)2-9/h1-6,8,20,24,27-29,31-42H,7H2/t20-,24+,27+,28-,29-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1cc(O)c(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Corylus avellana  | Ref. |
| Plantae | Cistaceae | Cistus incanus | Ref. |
| Plantae | Euphorbiaceae | Mallotus japonicus  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fagaceae | Quercus dentata | Ref. |
| Plantae | Grossulariaceae | Ribes nigrum  | Ref. |
| Plantae | Hamamelidaceae | Hamamelis sp. | Ref. |
| Plantae | Rhamnaceae | Ziziphus spina-christi  | Ref. |
|
|
zoom in
| Organism | Ziziphus spina-christi | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Sun,Phytochem.,26,(1987),1825 |
|---|
|