| Name |
Epicatechin-(4beta->6)-epicatechin-(4beta->8)-catechin |
| Formula |
C45H38O18 |
| Mw |
866.20581441 |
| CAS RN |
82801-35-2 |
| C_ID |
C00009086
, 
|
| InChIKey |
SXEONTJNLWOUBB-YRHGLQAANA-N |
| InChICode |
InChI=1S/C45H38O18/c46-18-10-27(54)33-31(11-18)61-43(16-2-5-21(48)25(52)8-16)40(59)37(33)34-29(56)14-32-36(39(34)58)38(41(60)44(62-32)17-3-6-22(49)26(53)9-17)35-28(55)13-23(50)19-12-30(57)42(63-45(19)35)15-1-4-20(47)24(51)7-15/h1-11,13-14,30,37-38,40-44,46-60H,12H2/t30-,37+,38-,40-,41-,42-,43-,44-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc2c(c1O)[C@H](c1c(O)cc(O)c3c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C3)[C@@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Betula spp. | Ref. |
| Plantae | Dioscoreaceae | Dioscorea cirrhosa | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Palmae | Areca catechu  | Ref. |
| Plantae | Pinaceae | Pinus taeda | Ref. |
| Plantae | Rhizophoraceae | Kandelia candel | Ref. |
| Plantae | Salicaceae | Salix spp. | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis vinifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Hsu,Chem.Pharm.Bull,33,(1985),3142 |
|---|
|