| Name |
Cernuoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
480-69-3 |
| C_ID |
C00008045
, 
|
| InChIKey |
ZZERRGHHDDWLEN-NXBQWJJBNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-15-18(27)19(28)20(29)21(32-15)31-13-6-9(23)5-12-16(13)17(26)14(30-12)4-8-1-2-10(24)11(25)3-8/h1-6,15,18-25,27-29H,7H2/b14-4+/t15-,18-,19+,20-,21-/m1/s1 |
| SMILES |
O=C1C(=Cc2ccc(O)c(O)c2)Oc2cc(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia dealbata | Ref. |
| Plantae | Gesneriaceae | Chirita micromusa | Ref. |
| Plantae | Gesneriaceae | Cyrtandra oblongifolia | Ref. |
| Plantae | Gesneriaceae | Didymocarpus malayanus | Ref. |
| Plantae | Gesneriaceae | Petrocosmea kerrii | Ref. |
| Plantae | Oxalidaceae | Oxalis cernua  | Ref. |
| Plantae | Plumbaginaceae | Limonium bonduellii | Ref. |
| Plantae | Rubiaceae | Mussaenda hirsutissima  | Ref. |
|
|
zoom in
| Organism | Mussaenda hirsutissima | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Geissman,J.Am.Chem.Soc.,77,(1955),4622
Harborne,Phytochem.,6,(1967),1643 |
|---|
|