| Name |
Palasitrin |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
494-49-5 |
| C_ID |
C00008044
, 
|
| InChIKey |
HXDMAFOJZRTAQK-WIFMXYSFNA-N |
| InChICode |
InChI=1S/C27H30O15/c28-8-17-20(32)22(34)24(36)26(41-17)38-11-2-3-12-14(7-11)39-16(19(12)31)6-10-1-4-13(30)15(5-10)40-27-25(37)23(35)21(33)18(9-29)42-27/h1-7,17-18,20-30,32-37H,8-9H2/b16-6-/t17-,18-,20-,21-,22+,23+,24-,25-,26-,27-/m1/s1 |
| SMILES |
O=C1C(=Cc2ccc(O)c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2)Oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)ccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Amphipterygium adstringens | Ref. |
| Plantae | Anacardiaceae | Malosma laurina | Ref. |
| Plantae | Anacardiaceae | Mangifera altissima  | Ref. |
| Plantae | Anacardiaceae | Metopium spp. | Ref. |
| Plantae | Anacardiaceae | Rhus spp. | Ref. |
| Plantae | Anacardiaceae | Spondias mombin  | Ref. |
| Plantae | Anacardiaceae | Toxicodendron diversilobum | Ref. |
| Plantae | Fabaceae | Butea frondosa  | Ref. |
| Plantae | Fabaceae | Butea monosperma  | Ref. |
|
|
zoom in
| Organism | Butea frondosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Puri,J.Chem.Soc.,(1955),1589
Young,Am.J.Bot.,66,(1979),502 |
|---|
|