| Name |
Trilobatin |
| Formula |
C21H24O10 |
| Mw |
436.13694699 |
| CAS RN |
4192-90-9 |
| C_ID |
C00007991
, 
|
| InChIKey |
GSTCPEBQYSOEHV-OHPGNTIMNA-N |
| InChICode |
InChI=1S/C21H24O10/c22-9-16-18(27)19(28)20(29)21(31-16)30-12-7-14(25)17(15(26)8-12)13(24)6-3-10-1-4-11(23)5-2-10/h1-2,4-5,7-8,16,18-23,25-29H,3,6,9H2/t16-,18+,19-,20+,21+/m0/s1 |
| SMILES |
O=C(CCc1ccc(O)cc1)c1c(O)cc(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Fagaceae | Lithocarpus liseifolius | Ref. |
| Plantae | Fagaceae | Lithocarpus litseifolius | Ref. |
| Plantae | Fagaceae | Lithocarpus polystachya | Ref. |
| Plantae | Fagaceae | Lithocarpus polystachyus | Ref. |
| Plantae | Rosaceae | Malus trilobata | Ref. |
| Plantae | Symplocaceae | Symplocos microcalyx | Ref. |
| Plantae | Vitaceae | Vitis piasezkii | Ref. |
| Plantae | Vitaceae | Vitis saccharifera | Ref. |
|
|
zoom in
| Organism | Vitis piasezkii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Williams,J.Chem.Soc.,(1961),4133
Tanaka,Planta Med.(suppl.),(1980),81 |
|---|
|