| Name |
(-)-beta-Peltatin
beta-Peltatin |
| Formula |
C22H22O8 |
| Mw |
414.13146768 |
| CAS RN |
518-29-6 |
| C_ID |
C00007208
, 
|
| InChIKey |
HLBPOYVRLSXWJJ-XUGCUHNJNA-N |
| InChICode |
InChI=1S/C22H22O8/c1-25-14-5-10(6-15(26-2)20(14)27-3)17-12-7-16-21(30-9-29-16)19(23)13(12)4-11-8-28-22(24)18(11)17/h5-7,11,17-18,23H,4,8-9H2,1-3H3/t11-,17+,18-/m0/s1 |
| SMILES |
COc1cc([C@@H]2c3cc4c(c(O)c3C[C@H]3COC(=O)[C@@H]32)OCO4)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum | Ref. |
| Plantae | Cupressaceae | Thujopsis dolabrata | Ref. |
| Plantae | Labiatae | Eriope blanchetii | Ref. |
| Plantae | Labiatae | Eriope macrostachya | Ref. |
| Plantae | Labiatae | Hyptis verticillata | Ref. |
| Plantae | Linaceae | Hugonia tomentosa | Ref. |
| Plantae | Linaceae | Linum album | Ref. |
| Plantae | Linaceae | Linum flavum var. compactum | Ref. |
| Plantae | Ranunculaceae | Pulsatilla chinensis | Ref. |
|
|
zoom in
| Organism | Linum album |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998) |
|---|
|
