| Name |
Isotaxiresinol (-)-Isotaxiresinol |
| Formula |
C19H22O6 |
| Mw |
346.14163844 |
| CAS RN |
26194-57-0 |
| C_ID |
C00007207
, 
|
| InChIKey |
GQLVRVYXAHDDLB-YAYBSETMNA-N |
| InChICode |
InChI=1S/C19H22O6/c1-25-18-6-11-4-12(8-20)14(9-21)19(13(11)7-17(18)24)10-2-3-15(22)16(23)5-10/h2-3,5-7,12,14,19-24H,4,8-9H2,1H3/t12-,14+,19-/m0/s1 |
| SMILES |
COc1cc2c(cc1O)[C@H](c1ccc(O)c(O)c1)[C@@H](CO)[C@H](CO)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Fitzroya cupressoides | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxaceae | Taxus brevifolia  | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Taxaceae | Taxus floridana | Ref. |
| Plantae | Taxaceae | Taxus mairei  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Taxus yunnanensis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Banskota, et al., Journal of Natural Products, 65, (2002), 1700.
Banskota, et al., Planta Med, 69, (2003), 500 |
|---|
|