| Name |
Pashanone |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
42438-78-8 |
| C_ID |
C00006959
, 
|
| InChIKey |
KVDNSLPRNTZIKF-CMDGGOBGSA-N |
| InChICode |
InChI=1S/C17H16O5/c1-21-14-10-13(19)15(16(20)17(14)22-2)12(18)9-8-11-6-4-3-5-7-11/h3-10,19-20H,1-2H3/b9-8+ |
| SMILES |
COc1cc(O)c(C(=O)/C=C/c2ccccc2)c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Uvaria scheffleri  | Ref. |
| Plantae | Gesneriaceae | Didymocarpus pedicellata  | Ref. |
| Plantae | Lauraceae | Lindera erythrocarpa | Ref. |
| Plantae | Lauraceae | Lindera umbellata  | Ref. |
| Plantae | Polygonaceae | Polygonum ferrugineum  | Ref. |
| Plantae | Pteridaceae | Onychium auratum | Ref. |
| Plantae | Pteridaceae | Onychium siliculosum | Ref. |
| Plantae | Pteridaceae | Platyzoma microphyllum | Ref. |
|
|
zoom in
| Organism | Platyzoma microphyllum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Agarwal,Indian J.Chem.,11,(1973),9
Ramakrishnan,Phytochem.,13,(1974),2317 |
|---|
|