| Name |
Perillanin Cyanidin 3-(6-p-coumaroylglucoside)-5-glucoside |
| Formula |
C36H37O18+ |
| Mw |
757.19798938 |
| CAS RN |
152885-69-3 |
| C_ID |
C00006819
, 
|
| InChIKey |
YPXWWSJGANMFFQ-LUWSFKKHNA-O |
| InChICode |
InChI=1S/C36H36O18/c37-13-25-28(43)30(45)32(47)35(53-25)51-23-11-18(39)10-22-19(23)12-24(34(50-22)16-4-7-20(40)21(41)9-16)52-36-33(48)31(46)29(44)26(54-36)14-49-27(42)8-3-15-1-5-17(38)6-2-15/h1-12,25-26,28-33,35-37,43-48H,13-14H2,(H3-,38,39,40,41,42)/p+1/t25-,26+,28+,29+,30-,31-,32-,33+,35+,36+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OCC1O[C@@H](Oc2cc3c(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Clinopodium spp. | Ref. |
| Plantae | Labiatae | Lamium grandiflorum | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Perilla nankinensis | Ref. |
| Plantae | Labiatae | Phlomis tuberosa | Ref. |
| Plantae | Labiatae | Salvia leucantha | Ref. |
| Plantae | Labiatae | Satureja fruticosa | Ref. |
| Plantae | Labiatae | Stachys macrantha | Ref. |
| Plantae | Labiatae | Stachys officinalis  | Ref. |
|
|
zoom in
| Organism | Stachys macrantha | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Goto,Tetrahedron Lett.,(1978),2413
Saito,Phytochem.,31,(1992),3009 |
|---|
|