| Name |
Gesnerin |
| Formula |
C21H21O9 |
| Mw |
417.11855727 |
| CAS RN |
19045-96-6 |
| C_ID |
C00006620
, 
|
| InChIKey |
SRKBASTXQAAMHZ-MHDJWYLPNA-O |
| InChICode |
InChI=1S/C21H20O9/c22-9-17-18(25)19(26)20(27)21(30-17)29-16-8-12(24)7-15-13(16)5-6-14(28-15)10-1-3-11(23)4-2-10/h1-8,17-22,25-27H,9H2,(H-,23,24)/p+1/t17-,18-,19+,20-,21-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc(O)cc3[o+]c(-c4ccc(O)cc4)ccc23)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Blechnaceae | Blechnum procerum | Ref. |
| Plantae | Gesneriaceae | Chrysothemis pulchella | Ref. |
| Plantae | Gesneriaceae | Gesneria fulgens | Ref. |
| Plantae | Gesneriaceae | Kohleria eriantha | Ref. |
| Plantae | Gesneriaceae | Rechsteineria macrorhiza | Ref. |
| Plantae | Gesneriaceae | Sinningia cardinalis | Ref. |
| Plantae | Poaceae | Sorghum vulgare  | Ref. |
| Plantae | Pteridaceae | Adiantum spp. | Ref. |
| Plantae | Pteridaceae | Pteris longifolia | Ref. |
| - | - | Gabneria fulgens | Ref. |
|
|
zoom in
| Organism | Adiantum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Robinson,Nature,130,(1932)21
Harborne,Phytochem.,5,(1966),589 |
|---|
|