| Name |
Bilobetin |
| Formula |
C31H20O10 |
| Mw |
552.10564686 |
| CAS RN |
521-32-4 |
| C_ID |
C00006488
, 
|
| InChIKey |
IWEIJEPIYMAGTH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C31H20O10/c1-39-24-7-4-15(26-12-22(37)29-19(34)9-17(33)10-27(29)40-26)8-18(24)28-20(35)11-21(36)30-23(38)13-25(41-31(28)30)14-2-5-16(32)6-3-14/h2-13,32-36H,1H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1-c1c(O)cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Araucaria bidwillii  | Ref. |
| Plantae | Boweniaceae | Bowenia spp. | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cupressaceae | Juniperus communis  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Podocarpaceae | Dacrydium spp. | Ref. |
| Plantae | Podocarpaceae | Lepidothamnus spp. | Ref. |
| Plantae | Podocarpaceae | Podocarpus elongatus | Ref. |
| Plantae | Podocarpaceae | Podocarpus montanus | Ref. |
| Plantae | Podocarpaceae | Prumnopitys spp. | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxaceae | Torreya nucifera  | Ref. |
| Plantae | Taxodiaceae | Taxodium distichum | Ref. |
| Plantae | Zamiaceae | Dioon spp. | Ref. |
| Plantae | Zamiaceae | Encephalartos spp. | Ref. |
| Plantae | Zamiaceae | Macrozamia spp. | Ref. |
| Plantae | Zamiaceae | Microcycas spp. | Ref. |
| Plantae | Zamiaceae | Zamia spp. | Ref. |
|
|
zoom in
| Organism | Lepidothamnus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Baker,J.Chem.Soc.,(1963),1477 |
|---|
|